C22H18BrF3N2O3S — CID 70685342
N-(4-bromophenyl)-N-methyl-3-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 70685342) has the molecular formula C22H18BrF3N2O3S and a molecular weight of 527.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-methyl-3-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-(4-bromophenyl)-N-methyl-3-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 70685342 |
| Molecular Formula | C22H18BrF3N2O3S |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | N-(4-bromophenyl)-N-methyl-3-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | CN(C(=O)c1cccc(S(=O)(=O)N(C)c2ccc(C(F)(F)F)cc2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrF3N2O3S/c1-27(18-12-8-17(23)9-13-18)21(29)15-4-3-5-20(14-15)32(30,31)28(2)19-10-6-16(7-11-19)22(24,25)26/h3-14H,1-2H3 |
| InChIKey | IPYFGULDINHYKG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |