C15H21N3O5S — CID 110677089
N-[3-(dimethylamino)propyl]-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide (PubChem CID 110677089) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110677089 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-ethyl-2,4-dioxo-3,1-benzoxazine-6-sulfonamide |
| SMILES | CCn1c(=O)oc(=O)c2cc(S(=O)(=O)NCCCN(C)C)ccc21 |
| InChI | InChI=1S/C15H21N3O5S/c1-4-18-13-7-6-11(10-12(13)14(19)23-15(18)20)24(21,22)16-8-5-9-17(2)3/h6-7,10,16H,4-5,8-9H2,1-3H3 |
| InChIKey | UYKBPZZVWZQCSX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|