C20H21N3O3 — CID 110414687
5-[4-(4-methoxybenzoyl)piperazin-1-yl]-1,3-dihydroindol-2-one (PubChem CID 110414687) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-[4-(4-methoxybenzoyl)piperazin-1-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[4-(4-methoxybenzoyl)piperazin-1-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110414687 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[4-(4-methoxybenzoyl)piperazin-1-yl]-1,3-dihydroindol-2-one |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc4c(c3)CC(=O)N4)CC2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-26-17-5-2-14(3-6-17)20(25)23-10-8-22(9-11-23)16-4-7-18-15(12-16)13-19(24)21-18/h2-7,12H,8-11,13H2,1H3,(H,21,24) |
| InChIKey | PNVZTGPDHZZPBT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|