C21H20ClN2O+ — CID 123489133
3-[4-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)phenyl]penta-1,3-dienyl-methyl-methylideneazanium (PubChem CID 123489133) has the molecular formula C21H20ClN2O+ and a molecular weight of 351.86 g/mol. Its IUPAC name is 3-[4-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)phenyl]penta-1,3-dienyl-methyl-methylideneazanium.
| Compound Name | 3-[4-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)phenyl]penta-1,3-dienyl-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123489133 |
| Molecular Formula | C21H20ClN2O+ |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[4-(6-chloro-2-oxo-1,3-dihydroindol-5-yl)phenyl]penta-1,3-dienyl-methyl-methylideneazanium |
| SMILES | C=[N+](C)C=CC(=CC)c1ccc(-c2cc3c(cc2Cl)NC(=O)C3)cc1 |
| InChI | InChI=1S/C21H19ClN2O/c1-4-14(9-10-24(2)3)15-5-7-16(8-6-15)18-11-17-12-21(25)23-20(17)13-19(18)22/h4-11,13H,2,12H2,1,3H3/p+1 |
| InChIKey | HUDWHUVHWKRDLZ-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|