C23H19N7O3 — CID 160703504
6-[[4,6-bis(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-1,3-dihydroindol-2-one (PubChem CID 160703504) has the molecular formula C23H19N7O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is 6-[[4,6-bis(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-[[4,6-bis(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 160703504 |
| Molecular Formula | C23H19N7O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 6-[[4,6-bis(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(Nc3nc(Nc4ccc(O)cc4)nc(Nc4ccc(O)cc4)n3)cc2N1 |
| InChI | InChI=1S/C23H19N7O3/c31-17-7-3-14(4-8-17)24-21-28-22(25-15-5-9-18(32)10-6-15)30-23(29-21)26-16-2-1-13-11-20(33)27-19(13)12-16/h1-10,12,31-32H,11H2,(H,27,33)(H3,24,25,26,28,29,30) |
| InChIKey | ZMVSNOOIRWWVBI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|