C16H11N4O3S- — CID 163637578
2-hydroxy-4-[(8-oxo-3-thia-7,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-13-yl)amino]phenolate (PubChem CID 163637578) has the molecular formula C16H11N4O3S- and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-hydroxy-4-[(8-oxo-3-thia-7,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-13-yl)amino]phenolate.
| Compound Name | 2-hydroxy-4-[(8-oxo-3-thia-7,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-13-yl)amino]phenolate |
|---|---|
| PubChem CID | 163637578 |
| Molecular Formula | C16H11N4O3S- |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-hydroxy-4-[(8-oxo-3-thia-7,12,14-triazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-13-yl)amino]phenolate |
| SMILES | O=C1Cc2cnc(Nc3ccc([O-])c(O)c3)nc2-c2sccc2N1 |
| InChI | InChI=1S/C16H12N4O3S/c21-11-2-1-9(6-12(11)22)18-16-17-7-8-5-13(23)19-10-3-4-24-15(10)14(8)20-16/h1-4,6-7,21-22H,5H2,(H,19,23)(H,17,18,20)/p-1 |
| InChIKey | IBMZOMXTKPMJPW-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |