C20H16N4O2 — CID 158241259
2-(3-ethenoxyanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 158241259) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-(3-ethenoxyanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 2-(3-ethenoxyanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 158241259 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(3-ethenoxyanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | C=COc1cccc(Nc2ncc3c(n2)-c2ccccc2NC(=O)C3)c1 |
| InChI | InChI=1S/C20H16N4O2/c1-2-26-15-7-5-6-14(11-15)22-20-21-12-13-10-18(25)23-17-9-4-3-8-16(17)19(13)24-20/h2-9,11-12H,1,10H2,(H,23,25)(H,21,22,24) |
| InChIKey | GFOJKVPTMQKWQX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|