C19H16N4O — CID 45379491
2-(4-methylanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 45379491) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(4-methylanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
| Compound Name | 2-(4-methylanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 45379491 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(4-methylanilino)-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | Cc1ccc(Nc2ncc3c(n2)-c2ccccc2NC(=O)C3)cc1 |
| InChI | InChI=1S/C19H16N4O/c1-12-6-8-14(9-7-12)21-19-20-11-13-10-17(24)22-16-5-3-2-4-15(16)18(13)23-19/h2-9,11H,10H2,1H3,(H,22,24)(H,20,21,23) |
| InChIKey | OLCKDNOSPFOVAT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |