C24H26N6O2 — CID 163749517
N-methyl-N-[3-(methylamino)propyl]-4-[(6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide (PubChem CID 163749517) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-methyl-N-[3-(methylamino)propyl]-4-[(6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide.
| Compound Name | N-methyl-N-[3-(methylamino)propyl]-4-[(6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 163749517 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-methyl-N-[3-(methylamino)propyl]-4-[(6-oxo-5,7-dihydropyrimido[5,4-d][1]benzazepin-2-yl)amino]benzamide |
| SMILES | CNCCCN(C)C(=O)c1ccc(Nc2ncc3c(n2)-c2ccccc2NC(=O)C3)cc1 |
| InChI | InChI=1S/C24H26N6O2/c1-25-12-5-13-30(2)23(32)16-8-10-18(11-9-16)27-24-26-15-17-14-21(31)28-20-7-4-3-6-19(20)22(17)29-24/h3-4,6-11,15,25H,5,12-14H2,1-2H3,(H,28,31)(H,26,27,29) |
| InChIKey | LOUHGLGALXTIKG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|