C18H17N3OS — CID 110318189
3-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]propanamide (PubChem CID 110318189) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]propanamide.
| Compound Name | 3-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110318189 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 3-phenyl-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C18H17N3OS/c22-17(7-6-14-4-2-1-3-5-14)20-12-18-21-16(13-23-18)15-8-10-19-11-9-15/h1-5,8-11,13H,6-7,12H2,(H,20,22) |
| InChIKey | CEFJGTIDIYSVNI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |