C11H11N3O2S — CID 121235637
N'-hydroxy-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethanimidamide (PubChem CID 121235637) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 121235637 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N'-hydroxy-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethanimidamide |
| SMILES | N/C(Cc1nc(-c2ccc(O)cc2)cs1)=N\O |
| InChI | InChI=1S/C11H11N3O2S/c12-10(14-16)5-11-13-9(6-17-11)7-1-3-8(15)4-2-7/h1-4,6,15-16H,5H2,(H2,12,14) |
| InChIKey | KCQAPKIMUQSGBV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|