C10H8FNOS — CID 130501430
2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-ol (PubChem CID 130501430) has the molecular formula C10H8FNOS and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-ol.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 130501430 |
| Molecular Formula | C10H8FNOS |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-ol |
| SMILES | Oc1csc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C10H8FNOS/c11-8-3-1-7(2-4-8)5-10-12-9(13)6-14-10/h1-4,6,13H,5H2 |
| InChIKey | UQHSQKKDCZJWRH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |