C25H21NO4S — CID 5128355
2-[4-[2,4-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-yl]acetic acid (PubChem CID 5128355) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-[4-[2,4-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-yl]acetic acid.
| Compound Name | 2-[4-[2,4-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 5128355 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[4-[2,4-bis(phenylmethoxy)phenyl]-1,3-thiazol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1nc(-c2ccc(OCc3ccccc3)cc2OCc2ccccc2)cs1 |
| InChI | InChI=1S/C25H21NO4S/c27-25(28)14-24-26-22(17-31-24)21-12-11-20(29-15-18-7-3-1-4-8-18)13-23(21)30-16-19-9-5-2-6-10-19/h1-13,17H,14-16H2,(H,27,28) |
| InChIKey | RKMKJUGTOQFYJC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |