C29H22NO4S4- — CID 59883722
(1Z)-4-[3-(5-methylsulfanyl-2-phenylmethoxyphenyl)thiophen-2-yl]-N-thiophen-2-ylsulfonylbenzenecarboximidate (PubChem CID 59883722) has the molecular formula C29H22NO4S4- and a molecular weight of 576.77 g/mol. Its IUPAC name is (1Z)-4-[3-(5-methylsulfanyl-2-phenylmethoxyphenyl)thiophen-2-yl]-N-thiophen-2-ylsulfonylbenzenecarboximidate.
| Compound Name | (1Z)-4-[3-(5-methylsulfanyl-2-phenylmethoxyphenyl)thiophen-2-yl]-N-thiophen-2-ylsulfonylbenzenecarboximidate |
|---|---|
| PubChem CID | 59883722 |
| Molecular Formula | C29H22NO4S4- |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | (1Z)-4-[3-(5-methylsulfanyl-2-phenylmethoxyphenyl)thiophen-2-yl]-N-thiophen-2-ylsulfonylbenzenecarboximidate |
| SMILES | CSc1ccc(OCc2ccccc2)c(-c2ccsc2-c2ccc(/C([O-])=N/S(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C29H23NO4S4/c1-35-23-13-14-26(34-19-20-6-3-2-4-7-20)25(18-23)24-15-17-37-28(24)21-9-11-22(12-10-21)29(31)30-38(32,33)27-8-5-16-36-27/h2-18H,19H2,1H3,(H,30,31)/p-1 |
| InChIKey | IIRAZEOMAOXKGC-UHFFFAOYSA-M |
| XLogP | 6.94 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|