C24H22O3S — CID 70346049
4-[(Z)-3-(5-methylsulfanyl-2-phenylmethoxyphenyl)prop-1-enyl]benzoic acid (PubChem CID 70346049) has the molecular formula C24H22O3S and a molecular weight of 390.50 g/mol. Its IUPAC name is 4-[(Z)-3-(5-methylsulfanyl-2-phenylmethoxyphenyl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-3-(5-methylsulfanyl-2-phenylmethoxyphenyl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 70346049 |
| Molecular Formula | C24H22O3S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-[(Z)-3-(5-methylsulfanyl-2-phenylmethoxyphenyl)prop-1-enyl]benzoic acid |
| SMILES | CSc1ccc(OCc2ccccc2)c(C/C=C\c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H22O3S/c1-28-22-14-15-23(27-17-19-6-3-2-4-7-19)21(16-22)9-5-8-18-10-12-20(13-11-18)24(25)26/h2-8,10-16H,9,17H2,1H3,(H,25,26)/b8-5- |
| InChIKey | MKPAFPGXBHVZHZ-YVMONPNESA-N |
| XLogP | 5.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |