C37H38O4 — CID 67020790
4-[3-[4-tert-butyl-3-(4-tert-butylphenyl)-5-phenylmethoxyphenyl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 67020790) has the molecular formula C37H38O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is 4-[3-[4-tert-butyl-3-(4-tert-butylphenyl)-5-phenylmethoxyphenyl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[3-[4-tert-butyl-3-(4-tert-butylphenyl)-5-phenylmethoxyphenyl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 67020790 |
| Molecular Formula | C37H38O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 4-[3-[4-tert-butyl-3-(4-tert-butylphenyl)-5-phenylmethoxyphenyl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(=O)C=Cc3ccc(C(=O)O)cc3)cc(OCc3ccccc3)c2C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H38O4/c1-36(2,3)30-19-17-27(18-20-30)31-22-29(32(38)21-14-25-12-15-28(16-13-25)35(39)40)23-33(34(31)37(4,5)6)41-24-26-10-8-7-9-11-26/h7-23H,24H2,1-6H3,(H,39,40) |
| InChIKey | HGZMQMLPSQFRCW-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|