C22H20ClNO5 — CID 144892144
3-(5-chloro-3-nitro-2-phenylmethoxyphenyl)benzoic acid;ethane (PubChem CID 144892144) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is 3-(5-chloro-3-nitro-2-phenylmethoxyphenyl)benzoic acid;ethane.
| Compound Name | 3-(5-chloro-3-nitro-2-phenylmethoxyphenyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 144892144 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-(5-chloro-3-nitro-2-phenylmethoxyphenyl)benzoic acid;ethane |
| SMILES | CC.O=C(O)c1cccc(-c2cc(Cl)cc([N+](=O)[O-])c2OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H14ClNO5.C2H6/c21-16-10-17(14-7-4-8-15(9-14)20(23)24)19(18(11-16)22(25)26)27-12-13-5-2-1-3-6-13;1-2/h1-11H,12H2,(H,23,24);1-2H3 |
| InChIKey | IYISOMMZURCYTL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|