C19H23ClN2O4 — CID 58657510
N-[2-(5-chloro-3-nitro-2-phenylmethoxyphenoxy)ethyl]-N-methylpropan-1-amine (PubChem CID 58657510) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-[2-(5-chloro-3-nitro-2-phenylmethoxyphenoxy)ethyl]-N-methylpropan-1-amine.
| Compound Name | N-[2-(5-chloro-3-nitro-2-phenylmethoxyphenoxy)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 58657510 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[2-(5-chloro-3-nitro-2-phenylmethoxyphenoxy)ethyl]-N-methylpropan-1-amine |
| SMILES | CCCN(C)CCOc1cc(Cl)cc([N+](=O)[O-])c1OCc1ccccc1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-3-9-21(2)10-11-25-18-13-16(20)12-17(22(23)24)19(18)26-14-15-7-5-4-6-8-15/h4-8,12-13H,3,9-11,14H2,1-2H3 |
| InChIKey | HAXLYKVUPZTWBY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|