C19H21ClN2O2 — CID 19375619
1-benzyl-4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazine (PubChem CID 19375619) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-benzyl-4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazine.
| Compound Name | 1-benzyl-4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazine |
|---|---|
| PubChem CID | 19375619 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-benzyl-4-(7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)piperazine |
| SMILES | Clc1cc2c(c(N3CCN(Cc4ccccc4)CC3)c1)OCCO2 |
| InChI | InChI=1S/C19H21ClN2O2/c20-16-12-17(19-18(13-16)23-10-11-24-19)22-8-6-21(7-9-22)14-15-4-2-1-3-5-15/h1-5,12-13H,6-11,14H2 |
| InChIKey | ICHKWZRXSWSIEH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |