C27H24BrNO4 — CID 142835393
5-[2-(5-bromo-2-phenylmethoxyphenyl)-6-methyl-4H-pyridin-1-yl]-2-methoxybenzoic acid (PubChem CID 142835393) has the molecular formula C27H24BrNO4 and a molecular weight of 506.40 g/mol. Its IUPAC name is 5-[2-(5-bromo-2-phenylmethoxyphenyl)-6-methyl-4H-pyridin-1-yl]-2-methoxybenzoic acid.
| Compound Name | 5-[2-(5-bromo-2-phenylmethoxyphenyl)-6-methyl-4H-pyridin-1-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 142835393 |
| Molecular Formula | C27H24BrNO4 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 5-[2-(5-bromo-2-phenylmethoxyphenyl)-6-methyl-4H-pyridin-1-yl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(N2C(C)=CCC=C2c2cc(Br)ccc2OCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C27H24BrNO4/c1-18-7-6-10-24(29(18)21-12-14-25(32-2)23(16-21)27(30)31)22-15-20(28)11-13-26(22)33-17-19-8-4-3-5-9-19/h3-5,7-16H,6,17H2,1-2H3,(H,30,31) |
| InChIKey | RJTLVFXMPDZVIZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |