C15H10BrF3O — CID 115786755
1-(3-bromo-5-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-one (PubChem CID 115786755) has the molecular formula C15H10BrF3O and a molecular weight of 343.14 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-one.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 115786755 |
| Molecular Formula | C15H10BrF3O |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-3-(3,4-difluorophenyl)propan-2-one |
| SMILES | O=C(Cc1cc(F)cc(Br)c1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10BrF3O/c16-11-3-10(4-12(17)8-11)6-13(20)5-9-1-2-14(18)15(19)7-9/h1-4,7-8H,5-6H2 |
| InChIKey | BFDARZYCGOJAOF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |