C17H16BrFO2 — CID 115786586
1-(3-bromo-5-fluorophenyl)-4-(4-methoxyphenyl)butan-2-one (PubChem CID 115786586) has the molecular formula C17H16BrFO2 and a molecular weight of 351.22 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-4-(4-methoxyphenyl)butan-2-one.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-4-(4-methoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 115786586 |
| Molecular Formula | C17H16BrFO2 |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-4-(4-methoxyphenyl)butan-2-one |
| SMILES | COc1ccc(CCC(=O)Cc2cc(F)cc(Br)c2)cc1 |
| InChI | InChI=1S/C17H16BrFO2/c1-21-17-6-3-12(4-7-17)2-5-16(20)10-13-8-14(18)11-15(19)9-13/h3-4,6-9,11H,2,5,10H2,1H3 |
| InChIKey | GCYQDPRKDAMUHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |