C15H19ClO — CID 114975097
(5-chloro-2-methylphenyl)-(4-methylcyclohexyl)methanone (PubChem CID 114975097) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is (5-chloro-2-methylphenyl)-(4-methylcyclohexyl)methanone.
| Compound Name | (5-chloro-2-methylphenyl)-(4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114975097 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (5-chloro-2-methylphenyl)-(4-methylcyclohexyl)methanone |
| SMILES | Cc1ccc(Cl)cc1C(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C15H19ClO/c1-10-3-6-12(7-4-10)15(17)14-9-13(16)8-5-11(14)2/h5,8-10,12H,3-4,6-7H2,1-2H3 |
| InChIKey | UUVYBJLLGCFQST-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |