C20H20F2N2O2 — CID 48869030
1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone (PubChem CID 48869030) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 48869030 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)N2CCN(C(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H20F2N2O2/c1-14-2-4-15(5-3-14)12-19(25)23-8-10-24(11-9-23)20(26)17-13-16(21)6-7-18(17)22/h2-7,13H,8-12H2,1H3 |
| InChIKey | ZNIDPMJXAAQQGA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |