C21H22F2N2O2 — CID 110815187
1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(2,4-dimethylphenyl)ethanone (PubChem CID 110815187) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(2,4-dimethylphenyl)ethanone.
| Compound Name | 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 110815187 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]-2-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)N2CCN(C(=O)c3cc(F)ccc3F)CC2)c(C)c1 |
| InChI | InChI=1S/C21H22F2N2O2/c1-14-3-4-16(15(2)11-14)12-20(26)24-7-9-25(10-8-24)21(27)18-13-17(22)5-6-19(18)23/h3-6,11,13H,7-10,12H2,1-2H3 |
| InChIKey | HVAWJHINKGFMII-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |