C23H37N3O2 — CID 66794706
1-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-(1-adamantyl)urea (PubChem CID 66794706) has the molecular formula C23H37N3O2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-(1-adamantyl)urea.
| Compound Name | 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-(1-adamantyl)urea |
|---|---|
| PubChem CID | 66794706 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | 1-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-oxopropyl]-3-(1-adamantyl)urea |
| SMILES | O=C(NCCC(=O)N1CCC2CCCCC2C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H37N3O2/c27-21(26-8-6-19-3-1-2-4-20(19)15-26)5-7-24-22(28)25-23-12-16-9-17(13-23)11-18(10-16)14-23/h16-20H,1-15H2,(H2,24,25,28) |
| InChIKey | DKJRDLBMEPWBAM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |