C21H36N4O2 — CID 119520066
1-(1-adamantyl)-3-[3-[4-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]urea (PubChem CID 119520066) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[4-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[4-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]urea |
|---|---|
| PubChem CID | 119520066 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[4-(1-aminoethyl)piperidin-1-yl]-3-oxopropyl]urea |
| SMILES | CC(N)C1CCN(C(=O)CCNC(=O)NC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C21H36N4O2/c1-14(22)18-3-6-25(7-4-18)19(26)2-5-23-20(27)24-21-11-15-8-16(12-21)10-17(9-15)13-21/h14-18H,2-13,22H2,1H3,(H2,23,24,27) |
| InChIKey | JGNFRVYYCGHARW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |