C16H29N3O2 — CID 104593878
1-(1-adamantyl)-3-[2-(2-hydroxypropylamino)ethyl]urea (PubChem CID 104593878) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[2-(2-hydroxypropylamino)ethyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[2-(2-hydroxypropylamino)ethyl]urea |
|---|---|
| PubChem CID | 104593878 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-(1-adamantyl)-3-[2-(2-hydroxypropylamino)ethyl]urea |
| SMILES | CC(O)CNCCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H29N3O2/c1-11(20)10-17-2-3-18-15(21)19-16-7-12-4-13(8-16)6-14(5-12)9-16/h11-14,17,20H,2-10H2,1H3,(H2,18,19,21) |
| InChIKey | XSJKFYYEZHCNNA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|