C20H21ClFN3O2 — CID 119787390
1-[2-(4-aminophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)piperidine-4-carboxamide (PubChem CID 119787390) has the molecular formula C20H21ClFN3O2 and a molecular weight of 389.86 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-aminophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119787390 |
| Molecular Formula | C20H21ClFN3O2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[2-(4-aminophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)piperidine-4-carboxamide |
| SMILES | Nc1ccc(CC(=O)N2CCC(C(=O)Nc3ccc(F)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H21ClFN3O2/c21-17-12-16(5-6-18(17)22)24-20(27)14-7-9-25(10-8-14)19(26)11-13-1-3-15(23)4-2-13/h1-6,12,14H,7-11,23H2,(H,24,27) |
| InChIKey | PEMATKPAPQZBEQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|