C20H19ClF2N2O2 — CID 113008999
1-[2-(4-chlorophenyl)acetyl]-N-(3,4-difluorophenyl)piperidine-4-carboxamide (PubChem CID 113008999) has the molecular formula C20H19ClF2N2O2 and a molecular weight of 392.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)acetyl]-N-(3,4-difluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-chlorophenyl)acetyl]-N-(3,4-difluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008999 |
| Molecular Formula | C20H19ClF2N2O2 |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)acetyl]-N-(3,4-difluorophenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C1CCN(C(=O)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19ClF2N2O2/c21-15-3-1-13(2-4-15)11-19(26)25-9-7-14(8-10-25)20(27)24-16-5-6-17(22)18(23)12-16/h1-6,12,14H,7-11H2,(H,24,27) |
| InChIKey | SDAOJEXBLCCXCM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |