C26H36ClN5O — CID 10227074
N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(3-methylimidazol-4-yl)ethylamino]ethylamino]benzamide (PubChem CID 10227074) has the molecular formula C26H36ClN5O and a molecular weight of 470.06 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(3-methylimidazol-4-yl)ethylamino]ethylamino]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(3-methylimidazol-4-yl)ethylamino]ethylamino]benzamide |
|---|---|
| PubChem CID | 10227074 |
| Molecular Formula | C26H36ClN5O |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(3-methylimidazol-4-yl)ethylamino]ethylamino]benzamide |
| SMILES | Cn1cncc1CCNCCNc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C26H36ClN5O/c1-32-17-29-15-22(32)4-5-28-6-7-30-21-2-3-24(27)23(11-21)25(33)31-16-26-12-18-8-19(13-26)10-20(9-18)14-26/h2-3,11,15,17-20,28,30H,4-10,12-14,16H2,1H3,(H,31,33) |
| InChIKey | RLZBXMQAIXKSQF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|