C25H38ClN3O2 — CID 10204118
N-(1-adamantylmethyl)-5-chloro-2-[3-[(3-hydroxy-2,2-dimethylpropyl)amino]propyl]pyridine-4-carboxamide (PubChem CID 10204118) has the molecular formula C25H38ClN3O2 and a molecular weight of 448.05 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-chloro-2-[3-[(3-hydroxy-2,2-dimethylpropyl)amino]propyl]pyridine-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-5-chloro-2-[3-[(3-hydroxy-2,2-dimethylpropyl)amino]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10204118 |
| Molecular Formula | C25H38ClN3O2 |
| Molecular Weight | 448.05 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | N-(1-adamantylmethyl)-5-chloro-2-[3-[(3-hydroxy-2,2-dimethylpropyl)amino]propyl]pyridine-4-carboxamide |
| SMILES | CC(C)(CO)CNCCCc1cc(C(=O)NCC23CC4CC(CC(C4)C2)C3)c(Cl)cn1 |
| InChI | InChI=1S/C25H38ClN3O2/c1-24(2,16-30)14-27-5-3-4-20-9-21(22(26)13-28-20)23(31)29-15-25-10-17-6-18(11-25)8-19(7-17)12-25/h9,13,17-19,27,30H,3-8,10-12,14-16H2,1-2H3,(H,29,31) |
| InChIKey | OAIXBIYKCGTYOA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|