C26H40Cl3N3O2 — CID 141235993
N-(1-adamantylmethyl)-5-chloro-2-[3-[(4-hydroxycyclohexyl)amino]propyl]pyridine-4-carboxamide;dihydrochloride (PubChem CID 141235993) has the molecular formula C26H40Cl3N3O2 and a molecular weight of 532.98 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-chloro-2-[3-[(4-hydroxycyclohexyl)amino]propyl]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-(1-adamantylmethyl)-5-chloro-2-[3-[(4-hydroxycyclohexyl)amino]propyl]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 141235993 |
| Molecular Formula | C26H40Cl3N3O2 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | N-(1-adamantylmethyl)-5-chloro-2-[3-[(4-hydroxycyclohexyl)amino]propyl]pyridine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(CCCNC2CCC(O)CC2)ncc1Cl |
| InChI | InChI=1S/C26H38ClN3O2.2ClH/c27-24-15-29-21(2-1-7-28-20-3-5-22(31)6-4-20)11-23(24)25(32)30-16-26-12-17-8-18(13-26)10-19(9-17)14-26;;/h11,15,17-20,22,28,31H,1-10,12-14,16H2,(H,30,32);2*1H |
| InChIKey | LFEGELVWOGCTJU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|