C13H12F3NO2 — CID 104580561
2,4,5-trifluoro-N-hex-5-yn-3-yl-3-hydroxybenzamide (PubChem CID 104580561) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-hex-5-yn-3-yl-3-hydroxybenzamide.
| Compound Name | 2,4,5-trifluoro-N-hex-5-yn-3-yl-3-hydroxybenzamide |
|---|---|
| PubChem CID | 104580561 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2,4,5-trifluoro-N-hex-5-yn-3-yl-3-hydroxybenzamide |
| SMILES | C#CCC(CC)NC(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H12F3NO2/c1-3-5-7(4-2)17-13(19)8-6-9(14)11(16)12(18)10(8)15/h1,6-7,18H,4-5H2,2H3,(H,17,19) |
| InChIKey | XZDDUFXNGGFNNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|