C13H10Cl2O2S — CID 43344791
(2,5-dichlorothiophen-3-yl)-(2-ethoxyphenyl)methanone (PubChem CID 43344791) has the molecular formula C13H10Cl2O2S and a molecular weight of 301.19 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2-ethoxyphenyl)methanone.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 43344791 |
| Molecular Formula | C13H10Cl2O2S |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H10Cl2O2S/c1-2-17-10-6-4-3-5-8(10)12(16)9-7-11(14)18-13(9)15/h3-7H,2H2,1H3 |
| InChIKey | VTLXKPKPAPKDQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |