[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate

C16H14O5 — CID 174463979

IUPAC[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate
SMILESCCOc1ccccc1C(=O)c1ccccc1OC(=O)O
InChIInChI=1S/C16H14O5/c1-2-20-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)21-16(18)19/h3-10H,2H2,1H3,(H,18,19)
InChIKeyJOIORHMGVVRUJL-UHFFFAOYSA-N
MW286.28 g/mol
LogP3.37
Rot. Bonds5

About [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate

[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate (PubChem CID 174463979) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate.

Molecular Properties

Compound Name[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate
PubChem CID174463979
Molecular FormulaC16H14O5
Molecular Weight286.28 g/mol
Exact Mass286.08
IUPAC Name[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate
SMILESCCOc1ccccc1C(=O)c1ccccc1OC(=O)O
InChIInChI=1S/C16H14O5/c1-2-20-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)21-16(18)19/h3-10H,2H2,1H3,(H,18,19)
InChIKeyJOIORHMGVVRUJL-UHFFFAOYSA-N
XLogP3.37
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.28
LogP ≤ 53.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate?
The IUPAC name of [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate (CID 174463979) is [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate.
What is the SMILES notation for [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate?
The canonical SMILES for [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate is CCOc1ccccc1C(=O)c1ccccc1OC(=O)O.
What is the InChIKey of [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate?
The InChIKey is JOIORHMGVVRUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-2-20-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)21-16(18)19/h3-10H,2H2,1H3,(H,18,19).
What are the key properties of [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate?
[2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate has a molecular weight of 286.28 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-ethoxybenzoyl)phenyl] hydrogen carbonate is sourced from PubChem (CID 174463979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).