C14H19ClO — CID 115483423
1-(2-chloro-4,5-dimethylphenyl)-2-ethylbutan-1-one (PubChem CID 115483423) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)-2-ethylbutan-1-one.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 115483423 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C14H19ClO/c1-5-11(6-2)14(16)12-7-9(3)10(4)8-13(12)15/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | UKVBFGPIHCBCRN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |