C14H20ClNO2 — CID 116923895
1-(5-chloro-4-methoxy-2-methylphenyl)-2-(methylaminomethyl)butan-1-one (PubChem CID 116923895) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-(5-chloro-4-methoxy-2-methylphenyl)-2-(methylaminomethyl)butan-1-one.
| Compound Name | 1-(5-chloro-4-methoxy-2-methylphenyl)-2-(methylaminomethyl)butan-1-one |
|---|---|
| PubChem CID | 116923895 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(5-chloro-4-methoxy-2-methylphenyl)-2-(methylaminomethyl)butan-1-one |
| SMILES | CCC(CNC)C(=O)c1cc(Cl)c(OC)cc1C |
| InChI | InChI=1S/C14H20ClNO2/c1-5-10(8-16-3)14(17)11-7-12(15)13(18-4)6-9(11)2/h6-7,10,16H,5,8H2,1-4H3 |
| InChIKey | BUFPQNGQOUUJGF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |