C19H27ClN2O3 — CID 110801762
1-[4-(5-chloro-2-methoxy-4-methylbenzoyl)piperazin-1-yl]-2-ethylbutan-1-one (PubChem CID 110801762) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methoxy-4-methylbenzoyl)piperazin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[4-(5-chloro-2-methoxy-4-methylbenzoyl)piperazin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 110801762 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[4-(5-chloro-2-methoxy-4-methylbenzoyl)piperazin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCN(C(=O)c2cc(Cl)c(C)cc2OC)CC1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-5-14(6-2)18(23)21-7-9-22(10-8-21)19(24)15-12-16(20)13(3)11-17(15)25-4/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | FFTLCODEWGSQOG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |