C14H19BrO — CID 114329579
1-(4-bromo-3,5-dimethylphenyl)-2-ethylbutan-1-one (PubChem CID 114329579) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-2-ethylbutan-1-one.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 114329579 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H19BrO/c1-5-11(6-2)14(16)12-7-9(3)13(15)10(4)8-12/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | DZSGSVSZHRALCO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |