C18H19BrO — CID 114329542
1-(4-bromo-3,5-dimethylphenyl)-2-(4-ethylphenyl)ethanone (PubChem CID 114329542) has the molecular formula C18H19BrO and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-2-(4-ethylphenyl)ethanone.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(4-ethylphenyl)ethanone |
|---|---|
| PubChem CID | 114329542 |
| Molecular Formula | C18H19BrO |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(4-ethylphenyl)ethanone |
| SMILES | CCc1ccc(CC(=O)c2cc(C)c(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C18H19BrO/c1-4-14-5-7-15(8-6-14)11-17(20)16-9-12(2)18(19)13(3)10-16/h5-10H,4,11H2,1-3H3 |
| InChIKey | MEYWDKZXNCZRCF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |