C14H13BrO2 — CID 114329742
1-(4-bromo-3,5-dimethylphenyl)-2-(furan-2-yl)ethanone (PubChem CID 114329742) has the molecular formula C14H13BrO2 and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-2-(furan-2-yl)ethanone.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 114329742 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-2-(furan-2-yl)ethanone |
| SMILES | Cc1cc(C(=O)Cc2ccco2)cc(C)c1Br |
| InChI | InChI=1S/C14H13BrO2/c1-9-6-11(7-10(2)14(9)15)13(16)8-12-4-3-5-17-12/h3-7H,8H2,1-2H3 |
| InChIKey | FDJQFFQLGGOWDK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |