C12H12O2S — CID 115795642
1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanone (PubChem CID 115795642) has the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanone.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 115795642 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanone |
| SMILES | Cc1cc(C(=O)Cc2ccco2)sc1C |
| InChI | InChI=1S/C12H12O2S/c1-8-6-12(15-9(8)2)11(13)7-10-4-3-5-14-10/h3-6H,7H2,1-2H3 |
| InChIKey | DBTCIVMFGMCWAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |