C12H8Cl2O2 — CID 83172219
1-(3,4-dichlorophenyl)-2-(furan-2-yl)ethanone (PubChem CID 83172219) has the molecular formula C12H8Cl2O2 and a molecular weight of 255.10 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(furan-2-yl)ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 83172219 |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(furan-2-yl)ethanone |
| SMILES | O=C(Cc1ccco1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2O2/c13-10-4-3-8(6-11(10)14)12(15)7-9-2-1-5-16-9/h1-6H,7H2 |
| InChIKey | GGLDPNRVJKKVLJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |