2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid

C10H9Br2NO4 — CID 107971162

IUPAC2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid
SMILESO=C(NC(CO)C(=O)O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C10H9Br2NO4/c11-6-1-5(2-7(12)3-6)9(15)13-8(4-14)10(16)17/h1-3,8,14H,4H2,(H,13,15)(H,16,17)
InChIKeyJADLKBXBKBQJJP-UHFFFAOYSA-N
MW366.99 g/mol
LogP1.39
Rot. Bonds4

About 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid

2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 107971162) has the molecular formula C10H9Br2NO4 and a molecular weight of 366.99 g/mol. Its IUPAC name is 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid.

Molecular Properties

Compound Name2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid
PubChem CID107971162
Molecular FormulaC10H9Br2NO4
Molecular Weight366.99 g/mol
Exact Mass364.89
IUPAC Name2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid
SMILESO=C(NC(CO)C(=O)O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C10H9Br2NO4/c11-6-1-5(2-7(12)3-6)9(15)13-8(4-14)10(16)17/h1-3,8,14H,4H2,(H,13,15)(H,16,17)
InChIKeyJADLKBXBKBQJJP-UHFFFAOYSA-N
XLogP1.39
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.99
LogP ≤ 51.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid?
The IUPAC name of 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid (CID 107971162) is 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid.
What is the SMILES notation for 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid?
The canonical SMILES for 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid is O=C(NC(CO)C(=O)O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid?
The InChIKey is JADLKBXBKBQJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Br2NO4/c11-6-1-5(2-7(12)3-6)9(15)13-8(4-14)10(16)17/h1-3,8,14H,4H2,(H,13,15)(H,16,17).
What are the key properties of 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid?
2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid has a molecular weight of 366.99 g/mol, XLogP of 1.39, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dibromobenzoyl)amino]-3-hydroxypropanoic acid is sourced from PubChem (CID 107971162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).