C11H10BrF3INO — CID 113461627
5-bromo-2-iodo-N-(4,4,4-trifluorobutan-2-yl)benzamide (PubChem CID 113461627) has the molecular formula C11H10BrF3INO and a molecular weight of 436.01 g/mol. Its IUPAC name is 5-bromo-2-iodo-N-(4,4,4-trifluorobutan-2-yl)benzamide.
| Compound Name | 5-bromo-2-iodo-N-(4,4,4-trifluorobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113461627 |
| Molecular Formula | C11H10BrF3INO |
| Molecular Weight | 436.01 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | 5-bromo-2-iodo-N-(4,4,4-trifluorobutan-2-yl)benzamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C11H10BrF3INO/c1-6(5-11(13,14)15)17-10(18)8-4-7(12)2-3-9(8)16/h2-4,6H,5H2,1H3,(H,17,18) |
| InChIKey | FWODNXWFONPNDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.01 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|