C9H6I3NO3 — CID 23357591
N-acetyl-3,5-diiodo-2-iodosylbenzamide (PubChem CID 23357591) has the molecular formula C9H6I3NO3 and a molecular weight of 556.86 g/mol. Its IUPAC name is N-acetyl-3,5-diiodo-2-iodosylbenzamide.
| Compound Name | N-acetyl-3,5-diiodo-2-iodosylbenzamide |
|---|---|
| PubChem CID | 23357591 |
| Molecular Formula | C9H6I3NO3 |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.75 |
| IUPAC Name | N-acetyl-3,5-diiodo-2-iodosylbenzamide |
| SMILES | CC(=O)NC(=O)c1cc(I)cc(I)c1I=O |
| InChI | InChI=1S/C9H6I3NO3/c1-4(14)13-9(15)6-2-5(10)3-7(11)8(6)12-16/h2-3H,1H3,(H,13,14,15) |
| InChIKey | GNFIPUAHHDWVMT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|