C13H13F3INO — CID 171921545
N-cyclopentyl-4-iodo-2-(trifluoromethyl)benzamide (PubChem CID 171921545) has the molecular formula C13H13F3INO and a molecular weight of 383.15 g/mol. Its IUPAC name is N-cyclopentyl-4-iodo-2-(trifluoromethyl)benzamide.
| Compound Name | N-cyclopentyl-4-iodo-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171921545 |
| Molecular Formula | C13H13F3INO |
| Molecular Weight | 383.15 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-cyclopentyl-4-iodo-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(I)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3INO/c14-13(15,16)11-7-8(17)5-6-10(11)12(19)18-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,18,19) |
| InChIKey | PNSVGMJCVHWPRR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|