C15H15F6NO — CID 164895040
N-cyclohexyl-2,6-bis(trifluoromethyl)benzamide (PubChem CID 164895040) has the molecular formula C15H15F6NO and a molecular weight of 339.28 g/mol. Its IUPAC name is N-cyclohexyl-2,6-bis(trifluoromethyl)benzamide.
| Compound Name | N-cyclohexyl-2,6-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164895040 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-cyclohexyl-2,6-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C15H15F6NO/c16-14(17,18)10-7-4-8-11(15(19,20)21)12(10)13(23)22-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H,22,23) |
| InChIKey | LKUDSDYVMJVRPX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |