C13H18N2O2 — CID 113345728
N-(3,3-dimethylcyclopentyl)-5-hydroxypyridine-3-carboxamide (PubChem CID 113345728) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 113345728 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-5-hydroxypyridine-3-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2cncc(O)c2)C1 |
| InChI | InChI=1S/C13H18N2O2/c1-13(2)4-3-10(6-13)15-12(17)9-5-11(16)8-14-7-9/h5,7-8,10,16H,3-4,6H2,1-2H3,(H,15,17) |
| InChIKey | QSDZPJRQPZIXHY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |